About S-(2-ethylhexyl) (2S)-2-hydroxy-3-nonoxybutanethioate
S-(2-ethylhexyl) (2S)-2-hydroxy-3-nonoxybutanethioate (PubChem CID 88614937) has the molecular formula C21H42O3S
and a molecular weight of 374.63 g/mol. Its IUPAC name is S-(2-ethylhexyl) (2S)-2-hydroxy-3-nonoxybutanethioate.
Molecular Properties
| Compound Name | S-(2-ethylhexyl) (2S)-2-hydroxy-3-nonoxybutanethioate |
| PubChem CID | 88614937 |
| Molecular Formula | C21H42O3S |
| Molecular Weight | 374.63 g/mol |
| Exact Mass | 374.29 |
| IUPAC Name | S-(2-ethylhexyl) (2S)-2-hydroxy-3-nonoxybutanethioate |
| SMILES | CCCCCCCCCOC(C)[C@H](O)C(=O)SCC(CC)CCCC |
| InChI | InChI=1S/C21H42O3S/c1-5-8-10-11-12-13-14-16-24-18(4)20(22)21(23)25-17-19(7-3)15-9-6-2/h18-20,22H,5-17H2,1-4H3/t18?,19?,20-/m0/s1 |
| InChIKey | ZWWWGGJZNFTAFV-MHJFOBGBSA-N |
| XLogP | 5.98 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.63 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(2-ethylhexyl) (2S)-2-hydroxy-3-nonoxybutanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(2-ethylhexyl) (2S)-2-hydroxy-3-nonoxybutanethioate?
The IUPAC name of S-(2-ethylhexyl) (2S)-2-hydroxy-3-nonoxybutanethioate (CID 88614937) is S-(2-ethylhexyl) (2S)-2-hydroxy-3-nonoxybutanethioate.
What is the SMILES notation for S-(2-ethylhexyl) (2S)-2-hydroxy-3-nonoxybutanethioate?
The canonical SMILES for S-(2-ethylhexyl) (2S)-2-hydroxy-3-nonoxybutanethioate is CCCCCCCCCOC(C)[C@H](O)C(=O)SCC(CC)CCCC.
What is the InChIKey of S-(2-ethylhexyl) (2S)-2-hydroxy-3-nonoxybutanethioate?
The InChIKey is ZWWWGGJZNFTAFV-MHJFOBGBSA-N. The full InChI is InChI=1S/C21H42O3S/c1-5-8-10-11-12-13-14-16-24-18(4)20(22)21(23)25-17-19(7-3)15-9-6-2/h18-20,22H,5-17H2,1-4H3/t18?,19?,20-/m0/s1.
What are the key properties of S-(2-ethylhexyl) (2S)-2-hydroxy-3-nonoxybutanethioate?
S-(2-ethylhexyl) (2S)-2-hydroxy-3-nonoxybutanethioate has a molecular weight of 374.63 g/mol, XLogP of 5.98, 17 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-(2-ethylhexyl) (2S)-2-hydroxy-3-nonoxybutanethioate is sourced from PubChem (CID 88614937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).