C12H9F12I — CID 88618808
4-(1,1,1,3,3,4,4,5,5,6,6,6-dodecafluoro-2-iodohexan-2-yl)cyclohexene (PubChem CID 88618808) has the molecular formula C12H9F12I and a molecular weight of 508.08 g/mol. Its IUPAC name is 4-(1,1,1,3,3,4,4,5,5,6,6,6-dodecafluoro-2-iodohexan-2-yl)cyclohexene.
| Compound Name | 4-(1,1,1,3,3,4,4,5,5,6,6,6-dodecafluoro-2-iodohexan-2-yl)cyclohexene |
|---|---|
| PubChem CID | 88618808 |
| Molecular Formula | C12H9F12I |
| Molecular Weight | 508.08 g/mol |
| Exact Mass | 507.96 |
| IUPAC Name | 4-(1,1,1,3,3,4,4,5,5,6,6,6-dodecafluoro-2-iodohexan-2-yl)cyclohexene |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(I)(C1CC=CCC1)C(F)(F)F |
| InChI | InChI=1S/C12H9F12I/c13-8(14,9(15,16)10(17,18)12(22,23)24)7(25,11(19,20)21)6-4-2-1-3-5-6/h1-2,6H,3-5H2 |
| InChIKey | XJPUPKNQDFSQHY-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.08 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|