C10H11F7 — CID 88887882
3-(1,1,2,2,3,3,3-heptafluoropropyl)-6-methylcyclohexene (PubChem CID 88887882) has the molecular formula C10H11F7 and a molecular weight of 264.18 g/mol. Its IUPAC name is 3-(1,1,2,2,3,3,3-heptafluoropropyl)-6-methylcyclohexene.
| Compound Name | 3-(1,1,2,2,3,3,3-heptafluoropropyl)-6-methylcyclohexene |
|---|---|
| PubChem CID | 88887882 |
| Molecular Formula | C10H11F7 |
| Molecular Weight | 264.18 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 3-(1,1,2,2,3,3,3-heptafluoropropyl)-6-methylcyclohexene |
| SMILES | CC1C=CC(C(F)(F)C(F)(F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C10H11F7/c1-6-2-4-7(5-3-6)8(11,12)9(13,14)10(15,16)17/h2,4,6-7H,3,5H2,1H3 |
| InChIKey | DVZSNCWLAMEOKN-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.18 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|