C11H8F4 — CID 134964338
8,9-bis(difluoromethylidene)bicyclo[3.2.2]nona-2,6-diene (PubChem CID 134964338) has the molecular formula C11H8F4 and a molecular weight of 216.18 g/mol. Its IUPAC name is 8,9-bis(difluoromethylidene)bicyclo[3.2.2]nona-2,6-diene.
| Compound Name | 8,9-bis(difluoromethylidene)bicyclo[3.2.2]nona-2,6-diene |
|---|---|
| PubChem CID | 134964338 |
| Molecular Formula | C11H8F4 |
| Molecular Weight | 216.18 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | 8,9-bis(difluoromethylidene)bicyclo[3.2.2]nona-2,6-diene |
| SMILES | FC(F)=C1C(=C(F)F)C2C=CC1C=CC2 |
| InChI | InChI=1S/C11H8F4/c12-10(13)8-6-2-1-3-7(5-4-6)9(8)11(14)15/h1-2,4-7H,3H2 |
| InChIKey | XDRMCYSYDGNHTM-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.18 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|