C14H16F5Y- — CID 58690125
[5,7,7,7-tetrafluoro-6-(fluoromethyl)heptan-3-yl]benzene;yttrium (PubChem CID 58690125) has the molecular formula C14H16F5Y- and a molecular weight of 368.18 g/mol. Its IUPAC name is [5,7,7,7-tetrafluoro-6-(fluoromethyl)heptan-3-yl]benzene;yttrium.
| Compound Name | [5,7,7,7-tetrafluoro-6-(fluoromethyl)heptan-3-yl]benzene;yttrium |
|---|---|
| PubChem CID | 58690125 |
| Molecular Formula | C14H16F5Y- |
| Molecular Weight | 368.18 g/mol |
| Exact Mass | 368.02 |
| IUPAC Name | [5,7,7,7-tetrafluoro-6-(fluoromethyl)heptan-3-yl]benzene;yttrium |
| SMILES | CCC(CC(F)C(CF)C(F)(F)F)c1cc[c-]cc1.[Y] |
| InChI | InChI=1S/C14H16F5.Y/c1-2-10(11-6-4-3-5-7-11)8-13(16)12(9-15)14(17,18)19;/h4-7,10,12-13H,2,8-9H2,1H3;/q-1; |
| InChIKey | DUEWOEWZDCTINO-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.18 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|