C38H46O16S3 — CID 88621935
4-O-[3-[[2,5-bis[(4-methoxy-4-oxobutanoyl)oxy]-3,4,6-trimethylphenyl]trisulfanyl]-4-(4-methoxy-4-oxobutanoyl)oxy-2,5,6-trimethylphenyl] 1-O-methyl butanedioate (PubChem CID 88621935) has the molecular formula C38H46O16S3 and a molecular weight of 854.97 g/mol. Its IUPAC name is 4-O-[3-[[2,5-bis[(4-methoxy-4-oxobutanoyl)oxy]-3,4,6-trimethylphenyl]trisulfanyl]-4-(4-methoxy-4-oxobutanoyl)oxy-2,5,6-trimethylphenyl] 1-O-methyl butanedioate.
| Compound Name | 4-O-[3-[[2,5-bis[(4-methoxy-4-oxobutanoyl)oxy]-3,4,6-trimethylphenyl]trisulfanyl]-4-(4-methoxy-4-oxobutanoyl)oxy-2,5,6-trimethylphenyl] 1-O-methyl butanedioate |
|---|---|
| PubChem CID | 88621935 |
| Molecular Formula | C38H46O16S3 |
| Molecular Weight | 854.97 g/mol |
| Exact Mass | 854.19 |
| IUPAC Name | 4-O-[3-[[2,5-bis[(4-methoxy-4-oxobutanoyl)oxy]-3,4,6-trimethylphenyl]trisulfanyl]-4-(4-methoxy-4-oxobutanoyl)oxy-2,5,6-trimethylphenyl] 1-O-methyl butanedioate |
| SMILES | COC(=O)CCC(=O)Oc1c(C)c(C)c(OC(=O)CCC(=O)OC)c(SSSc2c(C)c(OC(=O)CCC(=O)OC)c(C)c(C)c2OC(=O)CCC(=O)OC)c1C |
| InChI | InChI=1S/C38H46O16S3/c1-19-21(3)35(53-31(45)17-13-27(41)49-9)37(23(5)33(19)51-29(43)15-11-25(39)47-7)55-57-56-38-24(6)34(52-30(44)16-12-26(40)48-8)20(2)22(4)36(38)54-32(46)18-14-28(42)50-10/h11-18H2,1-10H3 |
| InChIKey | LKNGVNXATWTWMH-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 210.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 854.97 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|