C26H30O8S2 — CID 88621942
[4-acetyloxy-3-[(2,5-diacetyloxy-3,4,6-trimethylphenyl)disulfanyl]-2,5,6-trimethylphenyl] acetate (PubChem CID 88621942) has the molecular formula C26H30O8S2 and a molecular weight of 534.65 g/mol. Its IUPAC name is [4-acetyloxy-3-[(2,5-diacetyloxy-3,4,6-trimethylphenyl)disulfanyl]-2,5,6-trimethylphenyl] acetate.
| Compound Name | [4-acetyloxy-3-[(2,5-diacetyloxy-3,4,6-trimethylphenyl)disulfanyl]-2,5,6-trimethylphenyl] acetate |
|---|---|
| PubChem CID | 88621942 |
| Molecular Formula | C26H30O8S2 |
| Molecular Weight | 534.65 g/mol |
| Exact Mass | 534.14 |
| IUPAC Name | [4-acetyloxy-3-[(2,5-diacetyloxy-3,4,6-trimethylphenyl)disulfanyl]-2,5,6-trimethylphenyl] acetate |
| SMILES | CC(=O)Oc1c(C)c(C)c(OC(C)=O)c(SSc2c(C)c(OC(C)=O)c(C)c(C)c2OC(C)=O)c1C |
| InChI | InChI=1S/C26H30O8S2/c1-11-13(3)23(33-19(9)29)25(15(5)21(11)31-17(7)27)35-36-26-16(6)22(32-18(8)28)12(2)14(4)24(26)34-20(10)30/h1-10H3 |
| InChIKey | VHPSQSVHZHFMCT-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.65 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|