C16H15N5O — CID 88630902
(6aR)-7-cyano-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-4-carbohydrazide (PubChem CID 88630902) has the molecular formula C16H15N5O and a molecular weight of 293.33 g/mol. Its IUPAC name is (6aR)-7-cyano-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-4-carbohydrazide.
| Compound Name | (6aR)-7-cyano-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-4-carbohydrazide |
|---|---|
| PubChem CID | 88630902 |
| Molecular Formula | C16H15N5O |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | (6aR)-7-cyano-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-4-carbohydrazide |
| SMILES | N#CN1CCC=C2c3cccc4c3c(cn4C(=O)NN)C[C@H]21 |
| InChI | InChI=1S/C16H15N5O/c17-9-20-6-2-4-11-12-3-1-5-13-15(12)10(7-14(11)20)8-21(13)16(22)19-18/h1,3-5,8,14H,2,6-7,18H2,(H,19,22)/t14-/m1/s1 |
| InChIKey | BYQVTHGHFXSXRJ-CQSZACIVSA-N |
| XLogP | 1.57 |
| TPSA | 87.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|