C15H19ClN2O2 — CID 88634760
2-chloro-3-(2,2-diethoxyethylamino)-3-phenylprop-2-enenitrile (PubChem CID 88634760) has the molecular formula C15H19ClN2O2 and a molecular weight of 294.78 g/mol. Its IUPAC name is 2-chloro-3-(2,2-diethoxyethylamino)-3-phenylprop-2-enenitrile.
| Compound Name | 2-chloro-3-(2,2-diethoxyethylamino)-3-phenylprop-2-enenitrile |
|---|---|
| PubChem CID | 88634760 |
| Molecular Formula | C15H19ClN2O2 |
| Molecular Weight | 294.78 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 2-chloro-3-(2,2-diethoxyethylamino)-3-phenylprop-2-enenitrile |
| SMILES | CCOC(CNC(=C(Cl)C#N)c1ccccc1)OCC |
| InChI | InChI=1S/C15H19ClN2O2/c1-3-19-14(20-4-2)11-18-15(13(16)10-17)12-8-6-5-7-9-12/h5-9,14,18H,3-4,11H2,1-2H3 |
| InChIKey | GMDUSEWFEOHBBP-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.78 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|