C19H18N2O3Se — CID 88638466
8-methoxy-4,4-dimethyl-7-phenylmethoxychromeno[4,3-d]selenadiazole (PubChem CID 88638466) has the molecular formula C19H18N2O3Se and a molecular weight of 401.32 g/mol. Its IUPAC name is 8-methoxy-4,4-dimethyl-7-phenylmethoxychromeno[4,3-d]selenadiazole.
| Compound Name | 8-methoxy-4,4-dimethyl-7-phenylmethoxychromeno[4,3-d]selenadiazole |
|---|---|
| PubChem CID | 88638466 |
| Molecular Formula | C19H18N2O3Se |
| Molecular Weight | 401.32 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | 8-methoxy-4,4-dimethyl-7-phenylmethoxychromeno[4,3-d]selenadiazole |
| SMILES | COc1cc2c(cc1OCc1ccccc1)OC(C)(C)c1[se]nnc1-2 |
| InChI | InChI=1S/C19H18N2O3Se/c1-19(2)18-17(20-21-25-18)13-9-15(22-3)16(10-14(13)24-19)23-11-12-7-5-4-6-8-12/h4-10H,11H2,1-3H3 |
| InChIKey | VRMZPRPRWCMPKO-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.32 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|