C8H20Cl2N2Pt — CID 88641705
dichloroplatinum;2,5-dimethylhexane-3,4-diamine (PubChem CID 88641705) has the molecular formula C8H20Cl2N2Pt and a molecular weight of 410.25 g/mol. Its IUPAC name is dichloroplatinum;2,5-dimethylhexane-3,4-diamine.
| Compound Name | dichloroplatinum;2,5-dimethylhexane-3,4-diamine |
|---|---|
| PubChem CID | 88641705 |
| Molecular Formula | C8H20Cl2N2Pt |
| Molecular Weight | 410.25 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | dichloroplatinum;2,5-dimethylhexane-3,4-diamine |
| SMILES | CC(C)C(N)C(N)C(C)C.Cl[Pt]Cl |
| InChI | InChI=1S/C8H20N2.2ClH.Pt/c1-5(2)7(9)8(10)6(3)4;;;/h5-8H,9-10H2,1-4H3;2*1H;/q;;;+2/p-2 |
| InChIKey | PLTFSVYOHPWMDZ-UHFFFAOYSA-L |
| XLogP | 2.33 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.25 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |