About dicarboxy 2-methylidenebutanedioate
dicarboxy 2-methylidenebutanedioate (PubChem CID 88642276) has the molecular formula C7H6O8
and a molecular weight of 218.12 g/mol. Its IUPAC name is dicarboxy 2-methylidenebutanedioate.
Molecular Properties
| Compound Name | dicarboxy 2-methylidenebutanedioate |
| PubChem CID | 88642276 |
| Molecular Formula | C7H6O8 |
| Molecular Weight | 218.12 g/mol |
| Exact Mass | 218.01 |
| IUPAC Name | dicarboxy 2-methylidenebutanedioate |
| SMILES | C=C(CC(=O)OC(=O)O)C(=O)OC(=O)O |
| InChI | InChI=1S/C7H6O8/c1-3(5(9)15-7(12)13)2-4(8)14-6(10)11/h1-2H2,(H,10,11)(H,12,13) |
| InChIKey | WBYYACNHHLWUSR-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.12 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze dicarboxy 2-methylidenebutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dicarboxy 2-methylidenebutanedioate?
The IUPAC name of dicarboxy 2-methylidenebutanedioate (CID 88642276) is dicarboxy 2-methylidenebutanedioate.
What is the SMILES notation for dicarboxy 2-methylidenebutanedioate?
The canonical SMILES for dicarboxy 2-methylidenebutanedioate is C=C(CC(=O)OC(=O)O)C(=O)OC(=O)O.
What is the InChIKey of dicarboxy 2-methylidenebutanedioate?
The InChIKey is WBYYACNHHLWUSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O8/c1-3(5(9)15-7(12)13)2-4(8)14-6(10)11/h1-2H2,(H,10,11)(H,12,13).
What are the key properties of dicarboxy 2-methylidenebutanedioate?
dicarboxy 2-methylidenebutanedioate has a molecular weight of 218.12 g/mol, XLogP of 0.38, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dicarboxy 2-methylidenebutanedioate is sourced from PubChem (CID 88642276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).