C10H5ClN2O4 — CID 88648969
N-chloro-2-(1,3-dioxoisoindol-2-yl)-2-oxoacetamide (PubChem CID 88648969) has the molecular formula C10H5ClN2O4 and a molecular weight of 252.61 g/mol. Its IUPAC name is N-chloro-2-(1,3-dioxoisoindol-2-yl)-2-oxoacetamide.
| Compound Name | N-chloro-2-(1,3-dioxoisoindol-2-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 88648969 |
| Molecular Formula | C10H5ClN2O4 |
| Molecular Weight | 252.61 g/mol |
| Exact Mass | 251.99 |
| IUPAC Name | N-chloro-2-(1,3-dioxoisoindol-2-yl)-2-oxoacetamide |
| SMILES | O=C(NCl)C(=O)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C10H5ClN2O4/c11-12-7(14)10(17)13-8(15)5-3-1-2-4-6(5)9(13)16/h1-4H,(H,12,14) |
| InChIKey | FUTURIYLUXOGKB-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.61 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|