C11H9NO3 — CID 134831051
2-(3-hydroxyprop-1-en-2-yl)isoindole-1,3-dione (PubChem CID 134831051) has the molecular formula C11H9NO3 and a molecular weight of 203.20 g/mol. Its IUPAC name is 2-(3-hydroxyprop-1-en-2-yl)isoindole-1,3-dione.
| Compound Name | 2-(3-hydroxyprop-1-en-2-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 134831051 |
| Molecular Formula | C11H9NO3 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.06 |
| IUPAC Name | 2-(3-hydroxyprop-1-en-2-yl)isoindole-1,3-dione |
| SMILES | C=C(CO)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C11H9NO3/c1-7(6-13)12-10(14)8-4-2-3-5-9(8)11(12)15/h2-5,13H,1,6H2 |
| InChIKey | VYBAGFXBIAUWRT-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|