About acetonitrile;diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane
acetonitrile;diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane (PubChem CID 88652694) has the molecular formula C10H23NO5P2S2
and a molecular weight of 363.38 g/mol. Its IUPAC name is acetonitrile;diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane.
Molecular Properties
| Compound Name | acetonitrile;diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane |
| PubChem CID | 88652694 |
| Molecular Formula | C10H23NO5P2S2 |
| Molecular Weight | 363.38 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | acetonitrile;diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane |
| SMILES | CC#N.CCOP(=S)(OCC)OP(=S)(OCC)OCC |
| InChI | InChI=1S/C8H20O5P2S2.C2H3N/c1-5-9-14(16,10-6-2)13-15(17,11-7-3)12-8-4;1-2-3/h5-8H2,1-4H3;1H3 |
| InChIKey | YVSLKBCCPZCADE-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 69.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.38 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze acetonitrile;diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane?
The IUPAC name of acetonitrile;diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane (CID 88652694) is acetonitrile;diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane.
What is the SMILES notation for acetonitrile;diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane?
The canonical SMILES for acetonitrile;diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane is CC#N.CCOP(=S)(OCC)OP(=S)(OCC)OCC.
What is the InChIKey of acetonitrile;diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane?
The InChIKey is YVSLKBCCPZCADE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H20O5P2S2.C2H3N/c1-5-9-14(16,10-6-2)13-15(17,11-7-3)12-8-4;1-2-3/h5-8H2,1-4H3;1H3.
What are the key properties of acetonitrile;diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane?
acetonitrile;diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane has a molecular weight of 363.38 g/mol, XLogP of 4.13, 10 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane is sourced from PubChem (CID 88652694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).