C11H28O7P2S2 — CID 87872569
diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane;propane-1,3-diol (PubChem CID 87872569) has the molecular formula C11H28O7P2S2 and a molecular weight of 398.42 g/mol. Its IUPAC name is diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane;propane-1,3-diol.
| Compound Name | diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane;propane-1,3-diol |
|---|---|
| PubChem CID | 87872569 |
| Molecular Formula | C11H28O7P2S2 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane;propane-1,3-diol |
| SMILES | CCOP(=S)(OCC)OP(=S)(OCC)OCC.OCCCO |
| InChI | InChI=1S/C8H20O5P2S2.C3H8O2/c1-5-9-14(16,10-6-2)13-15(17,11-7-3)12-8-4;4-2-1-3-5/h5-8H2,1-4H3;4-5H,1-3H2 |
| InChIKey | UGJPDNIASLBEBC-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|