About diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane;methoxymethane
diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane;methoxymethane (PubChem CID 87974989) has the molecular formula C10H26O6P2S2
and a molecular weight of 368.39 g/mol. Its IUPAC name is diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane;methoxymethane.
Molecular Properties
| Compound Name | diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane;methoxymethane |
| PubChem CID | 87974989 |
| Molecular Formula | C10H26O6P2S2 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane;methoxymethane |
| SMILES | CCOP(=S)(OCC)OP(=S)(OCC)OCC.COC |
| InChI | InChI=1S/C8H20O5P2S2.C2H6O/c1-5-9-14(16,10-6-2)13-15(17,11-7-3)12-8-4;1-3-2/h5-8H2,1-4H3;1-2H3 |
| InChIKey | SWKFUWGLNPHRAO-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane;methoxymethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane;methoxymethane?
The IUPAC name of diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane;methoxymethane (CID 87974989) is diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane;methoxymethane.
What is the SMILES notation for diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane;methoxymethane?
The canonical SMILES for diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane;methoxymethane is CCOP(=S)(OCC)OP(=S)(OCC)OCC.COC.
What is the InChIKey of diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane;methoxymethane?
The InChIKey is SWKFUWGLNPHRAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H20O5P2S2.C2H6O/c1-5-9-14(16,10-6-2)13-15(17,11-7-3)12-8-4;1-3-2/h5-8H2,1-4H3;1-2H3.
What are the key properties of diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane;methoxymethane?
diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane;methoxymethane has a molecular weight of 368.39 g/mol, XLogP of 3.86, 10 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane;methoxymethane is sourced from PubChem (CID 87974989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).