C7H16NO4PS — CID 54723364
diethoxyphosphinothioyloxy-(methoxymethyl)-methylideneazanium (PubChem CID 54723364) has the molecular formula C7H16NO4PS and a molecular weight of 241.25 g/mol. Its IUPAC name is diethoxyphosphinothioyloxy-(methoxymethyl)-methylideneazanium.
| Compound Name | diethoxyphosphinothioyloxy-(methoxymethyl)-methylideneazanium |
|---|---|
| PubChem CID | 54723364 |
| Molecular Formula | C7H16NO4PS |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | diethoxyphosphinothioyloxy-(methoxymethyl)-methylideneazanium |
| SMILES | C=[N+]([CH-]OC)OP(=S)(OCC)OCC |
| InChI | InChI=1S/C7H16NO4PS/c1-5-10-13(14,11-6-2)12-8(3)7-9-4/h7H,3,5-6H2,1-2,4H3 |
| InChIKey | LSOSDRMVDIKAEM-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 39.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|