C8H19O9PS3 — CID 90912396
1-[ethoxy(1-sulfopropoxy)phosphinothioyl]oxypropane-1-sulfonic acid (PubChem CID 90912396) has the molecular formula C8H19O9PS3 and a molecular weight of 386.41 g/mol. Its IUPAC name is 1-[ethoxy(1-sulfopropoxy)phosphinothioyl]oxypropane-1-sulfonic acid.
| Compound Name | 1-[ethoxy(1-sulfopropoxy)phosphinothioyl]oxypropane-1-sulfonic acid |
|---|---|
| PubChem CID | 90912396 |
| Molecular Formula | C8H19O9PS3 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 385.99 |
| IUPAC Name | 1-[ethoxy(1-sulfopropoxy)phosphinothioyl]oxypropane-1-sulfonic acid |
| SMILES | CCOP(=S)(OC(CC)S(=O)(=O)O)OC(CC)S(=O)(=O)O |
| InChI | InChI=1S/C8H19O9PS3/c1-4-7(20(9,10)11)16-18(19,15-6-3)17-8(5-2)21(12,13)14/h7-8H,4-6H2,1-3H3,(H,9,10,11)(H,12,13,14) |
| InChIKey | RWQLTUWAKIAXTC-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|