C30H24O2S2 — CID 88654064
1-(2-butylphenyl)sulfanyl-8-(4-tritiophenyl)sulfanylanthracene-9,10-dione (PubChem CID 88654064) has the molecular formula C30H24O2S2 and a molecular weight of 482.66 g/mol. Its IUPAC name is 1-(2-butylphenyl)sulfanyl-8-(4-tritiophenyl)sulfanylanthracene-9,10-dione.
| Compound Name | 1-(2-butylphenyl)sulfanyl-8-(4-tritiophenyl)sulfanylanthracene-9,10-dione |
|---|---|
| PubChem CID | 88654064 |
| Molecular Formula | C30H24O2S2 |
| Molecular Weight | 482.66 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | 1-(2-butylphenyl)sulfanyl-8-(4-tritiophenyl)sulfanylanthracene-9,10-dione |
| SMILES | [3H]c1ccc(Sc2cccc3c2C(=O)c2c(Sc4ccccc4CCCC)cccc2C3=O)cc1 |
| InChI | InChI=1S/C30H24O2S2/c1-2-3-11-20-12-7-8-17-24(20)34-26-19-10-16-23-28(26)30(32)27-22(29(23)31)15-9-18-25(27)33-21-13-5-4-6-14-21/h4-10,12-19H,2-3,11H2,1H3/i4T |
| InChIKey | PAZISOHRHQOVNL-IBTRZKOZSA-N |
| XLogP | 8.11 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.66 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|