C11H27NO4 — CID 88656909
(2S)-2-amino-3-methylbutanoic acid;ethanol;ethoxyethane (PubChem CID 88656909) has the molecular formula C11H27NO4 and a molecular weight of 237.34 g/mol. Its IUPAC name is (2S)-2-amino-3-methylbutanoic acid;ethanol;ethoxyethane.
| Compound Name | (2S)-2-amino-3-methylbutanoic acid;ethanol;ethoxyethane |
|---|---|
| PubChem CID | 88656909 |
| Molecular Formula | C11H27NO4 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.19 |
| IUPAC Name | (2S)-2-amino-3-methylbutanoic acid;ethanol;ethoxyethane |
| SMILES | CC(C)[C@H](N)C(=O)O.CCO.CCOCC |
| InChI | InChI=1S/C5H11NO2.C4H10O.C2H6O/c1-3(2)4(6)5(7)8;1-3-5-4-2;1-2-3/h3-4H,6H2,1-2H3,(H,7,8);3-4H2,1-2H3;3H,2H2,1H3/t4-;;/m0../s1 |
| InChIKey | WQUOMQVCPZTXDP-FHNDMYTFSA-N |
| XLogP | 1.10 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |