C20H31FO2 — CID 88658301
(5Z,8Z,11E,14Z)-12-fluoroicosa-5,8,11,14-tetraenoic acid (PubChem CID 88658301) has the molecular formula C20H31FO2 and a molecular weight of 322.46 g/mol. Its IUPAC name is (5Z,8Z,11E,14Z)-12-fluoroicosa-5,8,11,14-tetraenoic acid.
| Compound Name | (5Z,8Z,11E,14Z)-12-fluoroicosa-5,8,11,14-tetraenoic acid |
|---|---|
| PubChem CID | 88658301 |
| Molecular Formula | C20H31FO2 |
| Molecular Weight | 322.46 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | (5Z,8Z,11E,14Z)-12-fluoroicosa-5,8,11,14-tetraenoic acid |
| SMILES | CCCCC/C=C\C/C(F)=C\C/C=C\C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C20H31FO2/c1-2-3-4-5-10-13-16-19(21)17-14-11-8-6-7-9-12-15-18-20(22)23/h7-11,13,17H,2-6,12,14-16,18H2,1H3,(H,22,23)/b9-7-,11-8-,13-10-,19-17+ |
| InChIKey | DVJPXWKAVCEKCM-STORLSOUSA-N |
| XLogP | 6.51 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.46 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|