About dihydroxy-sulfanyl-sulfanylidene-λ5-phosphane;octan-3-amine
dihydroxy-sulfanyl-sulfanylidene-λ5-phosphane;octan-3-amine (PubChem CID 88665123) has the molecular formula C8H22NO2PS2
and a molecular weight of 259.38 g/mol. Its IUPAC name is dihydroxy-sulfanyl-sulfanylidene-λ5-phosphane;octan-3-amine.
Molecular Properties
| Compound Name | dihydroxy-sulfanyl-sulfanylidene-λ5-phosphane;octan-3-amine |
| PubChem CID | 88665123 |
| Molecular Formula | C8H22NO2PS2 |
| Molecular Weight | 259.38 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | dihydroxy-sulfanyl-sulfanylidene-λ5-phosphane;octan-3-amine |
| SMILES | CCCCCC(N)CC.OP(O)(=S)S |
| InChI | InChI=1S/C8H19N.H3O2PS2/c1-3-5-6-7-8(9)4-2;1-3(2,4)5/h8H,3-7,9H2,1-2H3;(H3,1,2,4,5) |
| InChIKey | FTRDMDOOZFOQII-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.38 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze dihydroxy-sulfanyl-sulfanylidene-λ5-phosphane;octan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dihydroxy-sulfanyl-sulfanylidene-λ5-phosphane;octan-3-amine?
The IUPAC name of dihydroxy-sulfanyl-sulfanylidene-λ5-phosphane;octan-3-amine (CID 88665123) is dihydroxy-sulfanyl-sulfanylidene-λ5-phosphane;octan-3-amine.
What is the SMILES notation for dihydroxy-sulfanyl-sulfanylidene-λ5-phosphane;octan-3-amine?
The canonical SMILES for dihydroxy-sulfanyl-sulfanylidene-λ5-phosphane;octan-3-amine is CCCCCC(N)CC.OP(O)(=S)S.
What is the InChIKey of dihydroxy-sulfanyl-sulfanylidene-λ5-phosphane;octan-3-amine?
The InChIKey is FTRDMDOOZFOQII-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19N.H3O2PS2/c1-3-5-6-7-8(9)4-2;1-3(2,4)5/h8H,3-7,9H2,1-2H3;(H3,1,2,4,5).
What are the key properties of dihydroxy-sulfanyl-sulfanylidene-λ5-phosphane;octan-3-amine?
dihydroxy-sulfanyl-sulfanylidene-λ5-phosphane;octan-3-amine has a molecular weight of 259.38 g/mol, XLogP of 2.43, 5 rotatable bonds, 4 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dihydroxy-sulfanyl-sulfanylidene-λ5-phosphane;octan-3-amine is sourced from PubChem (CID 88665123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).