C28H35FO2 — CID 88668475
2-[4-(3-fluoropropyl)phenyl]-2-[4-[4-(3-oxopentyl)cyclohexyl]phenyl]acetaldehyde (PubChem CID 88668475) has the molecular formula C28H35FO2 and a molecular weight of 422.58 g/mol. Its IUPAC name is 2-[4-(3-fluoropropyl)phenyl]-2-[4-[4-(3-oxopentyl)cyclohexyl]phenyl]acetaldehyde.
| Compound Name | 2-[4-(3-fluoropropyl)phenyl]-2-[4-[4-(3-oxopentyl)cyclohexyl]phenyl]acetaldehyde |
|---|---|
| PubChem CID | 88668475 |
| Molecular Formula | C28H35FO2 |
| Molecular Weight | 422.58 g/mol |
| Exact Mass | 422.26 |
| IUPAC Name | 2-[4-(3-fluoropropyl)phenyl]-2-[4-[4-(3-oxopentyl)cyclohexyl]phenyl]acetaldehyde |
| SMILES | CCC(=O)CCC1CCC(c2ccc(C(C=O)c3ccc(CCCF)cc3)cc2)CC1 |
| InChI | InChI=1S/C28H35FO2/c1-2-27(31)18-9-22-5-10-23(11-6-22)24-14-16-26(17-15-24)28(20-30)25-12-7-21(8-13-25)4-3-19-29/h7-8,12-17,20,22-23,28H,2-6,9-11,18-19H2,1H3 |
| InChIKey | GJRNRNJPKZRVOG-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.58 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|