C25H35NO4 — CID 88676682
(Z)-N-[(1S,2S,3R,4R)-3-[(E)-3-hydroxy-4-phenylpent-1-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]-N-methoxyhept-5-enamide (PubChem CID 88676682) has the molecular formula C25H35NO4 and a molecular weight of 413.56 g/mol. Its IUPAC name is (Z)-N-[(1S,2S,3R,4R)-3-[(E)-3-hydroxy-4-phenylpent-1-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]-N-methoxyhept-5-enamide.
| Compound Name | (Z)-N-[(1S,2S,3R,4R)-3-[(E)-3-hydroxy-4-phenylpent-1-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]-N-methoxyhept-5-enamide |
|---|---|
| PubChem CID | 88676682 |
| Molecular Formula | C25H35NO4 |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.26 |
| IUPAC Name | (Z)-N-[(1S,2S,3R,4R)-3-[(E)-3-hydroxy-4-phenylpent-1-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]-N-methoxyhept-5-enamide |
| SMILES | C/C=C\CCCC(=O)N(OC)[C@H]1[C@@H](/C=C/C(O)C(C)c2ccccc2)[C@H]2CC[C@@H]1O2 |
| InChI | InChI=1S/C25H35NO4/c1-4-5-6-10-13-24(28)26(29-3)25-20(22-16-17-23(25)30-22)14-15-21(27)18(2)19-11-8-7-9-12-19/h4-5,7-9,11-12,14-15,18,20-23,25,27H,6,10,13,16-17H2,1-3H3/b5-4-,15-14+/t18?,20-,21?,22+,23-,25-/m0/s1 |
| InChIKey | YZDDDRXCJVZUQS-IRGRHNEXSA-N |
| XLogP | 4.39 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|