C29H42O7 — CID 54194675
5,6-dihydroxy-7-[(1S,2S,3R,4R)-3-[3-(oxan-2-yloxy)-4-phenylpent-1-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]heptanoic acid (PubChem CID 54194675) has the molecular formula C29H42O7 and a molecular weight of 502.65 g/mol. Its IUPAC name is 5,6-dihydroxy-7-[(1S,2S,3R,4R)-3-[3-(oxan-2-yloxy)-4-phenylpent-1-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]heptanoic acid.
| Compound Name | 5,6-dihydroxy-7-[(1S,2S,3R,4R)-3-[3-(oxan-2-yloxy)-4-phenylpent-1-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]heptanoic acid |
|---|---|
| PubChem CID | 54194675 |
| Molecular Formula | C29H42O7 |
| Molecular Weight | 502.65 g/mol |
| Exact Mass | 502.29 |
| IUPAC Name | 5,6-dihydroxy-7-[(1S,2S,3R,4R)-3-[3-(oxan-2-yloxy)-4-phenylpent-1-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]heptanoic acid |
| SMILES | CC(c1ccccc1)C(C=C[C@@H]1[C@H](CC(O)C(O)CCCC(=O)O)[C@@H]2CC[C@H]1O2)OC1CCCCO1 |
| InChI | InChI=1S/C29H42O7/c1-19(20-8-3-2-4-9-20)25(36-29-12-5-6-17-34-29)14-13-21-22(27-16-15-26(21)35-27)18-24(31)23(30)10-7-11-28(32)33/h2-4,8-9,13-14,19,21-27,29-31H,5-7,10-12,15-18H2,1H3,(H,32,33)/t19?,21-,22+,23?,24?,25?,26-,27+,29?/m1/s1 |
| InChIKey | PKYOAYPZAVTCBX-CTDYQBDQSA-N |
| XLogP | 4.42 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.65 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|