About calcium;[chloro(phenyl)methyl]benzene;oxido-oxo-phosphooxyphosphanium
calcium;[chloro(phenyl)methyl]benzene;oxido-oxo-phosphooxyphosphanium (PubChem CID 88679181) has the molecular formula C13H11CaClO5P2+2
and a molecular weight of 384.71 g/mol. Its IUPAC name is calcium;[chloro(phenyl)methyl]benzene;oxido-oxo-phosphooxyphosphanium.
Molecular Properties
| Compound Name | calcium;[chloro(phenyl)methyl]benzene;oxido-oxo-phosphooxyphosphanium |
| PubChem CID | 88679181 |
| Molecular Formula | C13H11CaClO5P2+2 |
| Molecular Weight | 384.71 g/mol |
| Exact Mass | 383.94 |
| IUPAC Name | calcium;[chloro(phenyl)methyl]benzene;oxido-oxo-phosphooxyphosphanium |
| SMILES | ClC(c1ccccc1)c1ccccc1.O=[P+]([O-])O[P+](=O)[O-].[Ca+2] |
| InChI | InChI=1S/C13H11Cl.Ca.O5P2/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;;1-6(2)5-7(3)4/h1-10,13H;;/q;+2; |
| InChIKey | GWMXQIXUIVPROY-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 89.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.71 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze calcium;[chloro(phenyl)methyl]benzene;oxido-oxo-phosphooxyphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;[chloro(phenyl)methyl]benzene;oxido-oxo-phosphooxyphosphanium?
The IUPAC name of calcium;[chloro(phenyl)methyl]benzene;oxido-oxo-phosphooxyphosphanium (CID 88679181) is calcium;[chloro(phenyl)methyl]benzene;oxido-oxo-phosphooxyphosphanium.
What is the SMILES notation for calcium;[chloro(phenyl)methyl]benzene;oxido-oxo-phosphooxyphosphanium?
The canonical SMILES for calcium;[chloro(phenyl)methyl]benzene;oxido-oxo-phosphooxyphosphanium is ClC(c1ccccc1)c1ccccc1.O=[P+]([O-])O[P+](=O)[O-].[Ca+2].
What is the InChIKey of calcium;[chloro(phenyl)methyl]benzene;oxido-oxo-phosphooxyphosphanium?
The InChIKey is GWMXQIXUIVPROY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11Cl.Ca.O5P2/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;;1-6(2)5-7(3)4/h1-10,13H;;/q;+2;.
What are the key properties of calcium;[chloro(phenyl)methyl]benzene;oxido-oxo-phosphooxyphosphanium?
calcium;[chloro(phenyl)methyl]benzene;oxido-oxo-phosphooxyphosphanium has a molecular weight of 384.71 g/mol, XLogP of 2.67, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;[chloro(phenyl)methyl]benzene;oxido-oxo-phosphooxyphosphanium is sourced from PubChem (CID 88679181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).