C16H15ClO6 — CID 88683455
[1-carboxyoxy-6-(4-chlorophenyl)hexa-1,3,5-trienyl] ethyl carbonate (PubChem CID 88683455) has the molecular formula C16H15ClO6 and a molecular weight of 338.74 g/mol. Its IUPAC name is [1-carboxyoxy-6-(4-chlorophenyl)hexa-1,3,5-trienyl] ethyl carbonate.
| Compound Name | [1-carboxyoxy-6-(4-chlorophenyl)hexa-1,3,5-trienyl] ethyl carbonate |
|---|---|
| PubChem CID | 88683455 |
| Molecular Formula | C16H15ClO6 |
| Molecular Weight | 338.74 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | [1-carboxyoxy-6-(4-chlorophenyl)hexa-1,3,5-trienyl] ethyl carbonate |
| SMILES | CCOC(=O)OC(=CC=CC=Cc1ccc(Cl)cc1)OC(=O)O |
| InChI | InChI=1S/C16H15ClO6/c1-2-21-16(20)23-14(22-15(18)19)7-5-3-4-6-12-8-10-13(17)11-9-12/h3-11H,2H2,1H3,(H,18,19) |
| InChIKey | QPSUUGRDIYWYHF-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.74 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|