C19H20O6 — CID 88683909
(1-carboxyoxy-5-methyl-8-phenylocta-1,3,5,7-tetraenyl) ethyl carbonate (PubChem CID 88683909) has the molecular formula C19H20O6 and a molecular weight of 344.36 g/mol. Its IUPAC name is (1-carboxyoxy-5-methyl-8-phenylocta-1,3,5,7-tetraenyl) ethyl carbonate.
| Compound Name | (1-carboxyoxy-5-methyl-8-phenylocta-1,3,5,7-tetraenyl) ethyl carbonate |
|---|---|
| PubChem CID | 88683909 |
| Molecular Formula | C19H20O6 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | (1-carboxyoxy-5-methyl-8-phenylocta-1,3,5,7-tetraenyl) ethyl carbonate |
| SMILES | CCOC(=O)OC(=CC=CC(C)=CC=Cc1ccccc1)OC(=O)O |
| InChI | InChI=1S/C19H20O6/c1-3-23-19(22)25-17(24-18(20)21)14-8-10-15(2)9-7-13-16-11-5-4-6-12-16/h4-14H,3H2,1-2H3,(H,20,21) |
| InChIKey | WUMWCZBLJRNSNQ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|