C22H25ClN2O4S2Te — CID 88685632
3-ethyl-2-[3-(3-ethyl-1,3-benzothiazol-2-ylidene)-2-methylprop-1-enyl]-5-methyl-5H-telluropyrano[2,3-d][1,3]thiazol-3-ium perchlorate (PubChem CID 88685632) has the molecular formula C22H25ClN2O4S2Te and a molecular weight of 608.64 g/mol. Its IUPAC name is 3-ethyl-2-[3-(3-ethyl-1,3-benzothiazol-2-ylidene)-2-methylprop-1-enyl]-5-methyl-5H-telluropyrano[2,3-d][1,3]thiazol-3-ium perchlorate.
| Compound Name | 3-ethyl-2-[3-(3-ethyl-1,3-benzothiazol-2-ylidene)-2-methylprop-1-enyl]-5-methyl-5H-telluropyrano[2,3-d][1,3]thiazol-3-ium perchlorate |
|---|---|
| PubChem CID | 88685632 |
| Molecular Formula | C22H25ClN2O4S2Te |
| Molecular Weight | 608.64 g/mol |
| Exact Mass | 610.00 |
| IUPAC Name | 3-ethyl-2-[3-(3-ethyl-1,3-benzothiazol-2-ylidene)-2-methylprop-1-enyl]-5-methyl-5H-telluropyrano[2,3-d][1,3]thiazol-3-ium perchlorate |
| SMILES | CCN1C(=CC(C)=Cc2sc3c([n+]2CC)[Te]C(C)C=C3)Sc2ccccc21.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C22H25N2S2Te.ClHO4/c1-5-23-17-9-7-8-10-18(17)25-20(23)13-15(3)14-21-24(6-2)22-19(26-21)12-11-16(4)27-22;2-1(3,4)5/h7-14,16H,5-6H2,1-4H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | YLLXLRYWLFKUEU-UHFFFAOYSA-M |
| XLogP | 0.34 |
| TPSA | 99.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.64 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|