C25H32N2O4S3Te — CID 88686000
3-[2-[2-[(3-ethyl-5,6-dimethyl-5H-telluropyrano[2,3-d][1,3]thiazol-3-ium-2-yl)methylidene]butylidene]-1,3-benzothiazol-3-yl]propane-1-sulfonic acid hydroxide (PubChem CID 88686000) has the molecular formula C25H32N2O4S3Te and a molecular weight of 648.34 g/mol. Its IUPAC name is 3-[2-[2-[(3-ethyl-5,6-dimethyl-5H-telluropyrano[2,3-d][1,3]thiazol-3-ium-2-yl)methylidene]butylidene]-1,3-benzothiazol-3-yl]propane-1-sulfonic acid hydroxide.
| Compound Name | 3-[2-[2-[(3-ethyl-5,6-dimethyl-5H-telluropyrano[2,3-d][1,3]thiazol-3-ium-2-yl)methylidene]butylidene]-1,3-benzothiazol-3-yl]propane-1-sulfonic acid hydroxide |
|---|---|
| PubChem CID | 88686000 |
| Molecular Formula | C25H32N2O4S3Te |
| Molecular Weight | 648.34 g/mol |
| Exact Mass | 650.06 |
| IUPAC Name | 3-[2-[2-[(3-ethyl-5,6-dimethyl-5H-telluropyrano[2,3-d][1,3]thiazol-3-ium-2-yl)methylidene]butylidene]-1,3-benzothiazol-3-yl]propane-1-sulfonic acid hydroxide |
| SMILES | CCC(=Cc1sc2c([n+]1CC)[Te]C(C)C(C)=C2)C=C1Sc2ccccc2N1CCCS(=O)(=O)O.[OH-] |
| InChI | InChI=1S/C25H30N2O3S3Te.H2O/c1-5-19(15-23-26(6-2)25-22(32-23)14-17(3)18(4)34-25)16-24-27(12-9-13-33(28,29)30)20-10-7-8-11-21(20)31-24;/h7-8,10-11,14-16,18H,5-6,9,12-13H2,1-4H3;1H2 |
| InChIKey | UADZNIRLHKCWDD-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.34 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|