C24H30N2O5S4Te — CID 88686349
3-[5-methoxy-2-[2-[(3-methyl-5-methylsulfanyl-5H-telluropyrano[2,3-d][1,3]thiazol-3-ium-2-yl)methylidene]butylidene]-1,3-benzothiazol-3-yl]propane-1-sulfonic acid hydroxide (PubChem CID 88686349) has the molecular formula C24H30N2O5S4Te and a molecular weight of 682.38 g/mol. Its IUPAC name is 3-[5-methoxy-2-[2-[(3-methyl-5-methylsulfanyl-5H-telluropyrano[2,3-d][1,3]thiazol-3-ium-2-yl)methylidene]butylidene]-1,3-benzothiazol-3-yl]propane-1-sulfonic acid hydroxide.
| Compound Name | 3-[5-methoxy-2-[2-[(3-methyl-5-methylsulfanyl-5H-telluropyrano[2,3-d][1,3]thiazol-3-ium-2-yl)methylidene]butylidene]-1,3-benzothiazol-3-yl]propane-1-sulfonic acid hydroxide |
|---|---|
| PubChem CID | 88686349 |
| Molecular Formula | C24H30N2O5S4Te |
| Molecular Weight | 682.38 g/mol |
| Exact Mass | 684.01 |
| IUPAC Name | 3-[5-methoxy-2-[2-[(3-methyl-5-methylsulfanyl-5H-telluropyrano[2,3-d][1,3]thiazol-3-ium-2-yl)methylidene]butylidene]-1,3-benzothiazol-3-yl]propane-1-sulfonic acid hydroxide |
| SMILES | CCC(=Cc1sc2c([n+]1C)[Te]C(SC)C=C2)C=C1Sc2ccc(OC)cc2N1CCCS(=O)(=O)O.[OH-] |
| InChI | InChI=1S/C24H28N2O4S4Te.H2O/c1-5-16(13-21-25(2)24-20(33-21)9-10-23(31-4)35-24)14-22-26(11-6-12-34(27,28)29)18-15-17(30-3)7-8-19(18)32-22;/h7-10,13-15,23H,5-6,11-12H2,1-4H3;1H2 |
| InChIKey | JLZVBNNXKWCSGC-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 100.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.38 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|