C24H54N2O7P+ — CID 88687437
N-(2,3-dihydroxypropyl)hexadecanamide;(2-hydroxy-1-phosphonoethyl)-trimethylazanium (PubChem CID 88687437) has the molecular formula C24H54N2O7P+ and a molecular weight of 513.68 g/mol. Its IUPAC name is N-(2,3-dihydroxypropyl)hexadecanamide;(2-hydroxy-1-phosphonoethyl)-trimethylazanium.
| Compound Name | N-(2,3-dihydroxypropyl)hexadecanamide;(2-hydroxy-1-phosphonoethyl)-trimethylazanium |
|---|---|
| PubChem CID | 88687437 |
| Molecular Formula | C24H54N2O7P+ |
| Molecular Weight | 513.68 g/mol |
| Exact Mass | 513.37 |
| IUPAC Name | N-(2,3-dihydroxypropyl)hexadecanamide;(2-hydroxy-1-phosphonoethyl)-trimethylazanium |
| SMILES | CCCCCCCCCCCCCCCC(=O)NCC(O)CO.C[N+](C)(C)C(CO)P(=O)(O)O |
| InChI | InChI=1S/C19H39NO3.C5H14NO4P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19(23)20-16-18(22)17-21;1-6(2,3)5(4-7)11(8,9)10/h18,21-22H,2-17H2,1H3,(H,20,23);5,7H,4H2,1-3H3,(H-,8,9,10)/p+1 |
| InChIKey | XTESNPABGHZYCI-UHFFFAOYSA-O |
| XLogP | 3.13 |
| TPSA | 147.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.68 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|