C17H16ClN7O7S — CID 88691243
methyl 5-[(6-chloro-2-pyridinyl)-[(4,6-dimethoxypyrimidin-2-yl)carbamoyl]sulfamoyl]-1H-pyrazole-4-carboxylate (PubChem CID 88691243) has the molecular formula C17H16ClN7O7S and a molecular weight of 497.88 g/mol. Its IUPAC name is methyl 5-[(6-chloro-2-pyridinyl)-[(4,6-dimethoxypyrimidin-2-yl)carbamoyl]sulfamoyl]-1H-pyrazole-4-carboxylate.
| Compound Name | methyl 5-[(6-chloro-2-pyridinyl)-[(4,6-dimethoxypyrimidin-2-yl)carbamoyl]sulfamoyl]-1H-pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 88691243 |
| Molecular Formula | C17H16ClN7O7S |
| Molecular Weight | 497.88 g/mol |
| Exact Mass | 497.05 |
| IUPAC Name | methyl 5-[(6-chloro-2-pyridinyl)-[(4,6-dimethoxypyrimidin-2-yl)carbamoyl]sulfamoyl]-1H-pyrazole-4-carboxylate |
| SMILES | COC(=O)c1cn[nH]c1S(=O)(=O)N(C(=O)Nc1nc(OC)cc(OC)n1)c1cccc(Cl)n1 |
| InChI | InChI=1S/C17H16ClN7O7S/c1-30-12-7-13(31-2)22-16(21-12)23-17(27)25(11-6-4-5-10(18)20-11)33(28,29)14-9(8-19-24-14)15(26)32-3/h4-8H,1-3H3,(H,19,24)(H,21,22,23,27) |
| InChIKey | RMKTYOYVVRLXGO-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 178.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.88 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|