C19H14Cl4F2O4 — CID 88691810
[difluoro-(4,6,7-trichloro-1,3-benzodioxol-5-yl)methyl] 2-(4-chlorophenyl)-3-methylbutanoate (PubChem CID 88691810) has the molecular formula C19H14Cl4F2O4 and a molecular weight of 486.13 g/mol. Its IUPAC name is [difluoro-(4,6,7-trichloro-1,3-benzodioxol-5-yl)methyl] 2-(4-chlorophenyl)-3-methylbutanoate.
| Compound Name | [difluoro-(4,6,7-trichloro-1,3-benzodioxol-5-yl)methyl] 2-(4-chlorophenyl)-3-methylbutanoate |
|---|---|
| PubChem CID | 88691810 |
| Molecular Formula | C19H14Cl4F2O4 |
| Molecular Weight | 486.13 g/mol |
| Exact Mass | 483.96 |
| IUPAC Name | [difluoro-(4,6,7-trichloro-1,3-benzodioxol-5-yl)methyl] 2-(4-chlorophenyl)-3-methylbutanoate |
| SMILES | CC(C)C(C(=O)OC(F)(F)c1c(Cl)c(Cl)c2c(c1Cl)OCO2)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H14Cl4F2O4/c1-8(2)11(9-3-5-10(20)6-4-9)18(26)29-19(24,25)12-13(21)15(23)17-16(14(12)22)27-7-28-17/h3-6,8,11H,7H2,1-2H3 |
| InChIKey | VKWCTGWGQKYJSZ-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.13 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|