C26H45N — CID 88700175
3,7,11,15-tetramethyl-N,N-bis(prop-2-enyl)hexadeca-1,3,14-trien-1-amine (PubChem CID 88700175) has the molecular formula C26H45N and a molecular weight of 371.65 g/mol. Its IUPAC name is 3,7,11,15-tetramethyl-N,N-bis(prop-2-enyl)hexadeca-1,3,14-trien-1-amine.
| Compound Name | 3,7,11,15-tetramethyl-N,N-bis(prop-2-enyl)hexadeca-1,3,14-trien-1-amine |
|---|---|
| PubChem CID | 88700175 |
| Molecular Formula | C26H45N |
| Molecular Weight | 371.65 g/mol |
| Exact Mass | 371.36 |
| IUPAC Name | 3,7,11,15-tetramethyl-N,N-bis(prop-2-enyl)hexadeca-1,3,14-trien-1-amine |
| SMILES | C=CCN(C=CC(C)=CCCC(C)CCCC(C)CCC=C(C)C)CC=C |
| InChI | InChI=1S/C26H45N/c1-8-20-27(21-9-2)22-19-26(7)18-12-17-25(6)16-11-15-24(5)14-10-13-23(3)4/h8-9,13,18-19,22,24-25H,1-2,10-12,14-17,20-21H2,3-7H3 |
| InChIKey | RUGUICZSKCVTHJ-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.65 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|