C11H15NO6 — CID 88702429
[bis(1-hydroxyethyl)amino] 2,5-dihydroxybenzoate (PubChem CID 88702429) has the molecular formula C11H15NO6 and a molecular weight of 257.24 g/mol. Its IUPAC name is [bis(1-hydroxyethyl)amino] 2,5-dihydroxybenzoate.
| Compound Name | [bis(1-hydroxyethyl)amino] 2,5-dihydroxybenzoate |
|---|---|
| PubChem CID | 88702429 |
| Molecular Formula | C11H15NO6 |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | [bis(1-hydroxyethyl)amino] 2,5-dihydroxybenzoate |
| SMILES | CC(O)N(OC(=O)c1cc(O)ccc1O)C(C)O |
| InChI | InChI=1S/C11H15NO6/c1-6(13)12(7(2)14)18-11(17)9-5-8(15)3-4-10(9)16/h3-7,13-16H,1-2H3 |
| InChIKey | QHNHFFKFSFSVNP-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 110.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.24 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|