C11H19F3O5S — CID 88706827
(2R)-2-ethyl-5,5-dimethyl-2-(trifluoromethylsulfonyloxy)hexanoic acid (PubChem CID 88706827) has the molecular formula C11H19F3O5S and a molecular weight of 320.33 g/mol. Its IUPAC name is (2R)-2-ethyl-5,5-dimethyl-2-(trifluoromethylsulfonyloxy)hexanoic acid.
| Compound Name | (2R)-2-ethyl-5,5-dimethyl-2-(trifluoromethylsulfonyloxy)hexanoic acid |
|---|---|
| PubChem CID | 88706827 |
| Molecular Formula | C11H19F3O5S |
| Molecular Weight | 320.33 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | (2R)-2-ethyl-5,5-dimethyl-2-(trifluoromethylsulfonyloxy)hexanoic acid |
| SMILES | CC[C@](CCC(C)(C)C)(OS(=O)(=O)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C11H19F3O5S/c1-5-10(8(15)16,7-6-9(2,3)4)19-20(17,18)11(12,13)14/h5-7H2,1-4H3,(H,15,16)/t10-/m1/s1 |
| InChIKey | JKTGZKKSSLNOCP-SNVBAGLBSA-N |
| XLogP | 2.91 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.33 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|