C6H5ClNa2O7 — CID 88717294
disodium;2-(carboxymethyl)-3-chloro-2-hydroxybutanedioate (PubChem CID 88717294) has the molecular formula C6H5ClNa2O7 and a molecular weight of 270.53 g/mol. Its IUPAC name is disodium;2-(carboxymethyl)-3-chloro-2-hydroxybutanedioate.
| Compound Name | disodium;2-(carboxymethyl)-3-chloro-2-hydroxybutanedioate |
|---|---|
| PubChem CID | 88717294 |
| Molecular Formula | C6H5ClNa2O7 |
| Molecular Weight | 270.53 g/mol |
| Exact Mass | 269.95 |
| IUPAC Name | disodium;2-(carboxymethyl)-3-chloro-2-hydroxybutanedioate |
| SMILES | O=C(O)CC(O)(C(=O)[O-])C(Cl)C(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C6H7ClO7.2Na/c7-3(4(10)11)6(14,5(12)13)1-2(8)9;;/h3,14H,1H2,(H,8,9)(H,10,11)(H,12,13);;/q;2*+1/p-2 |
| InChIKey | IEQOXYJAYOYGCT-UHFFFAOYSA-L |
| XLogP | -9.69 |
| TPSA | 137.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.53 |
| LogP ≤ 5 | -9.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|