C34H55O4PS2 — CID 88718459
bis(1-phenoxyundecan-2-yloxy)-sulfanyl-sulfanylidene-λ5-phosphane (PubChem CID 88718459) has the molecular formula C34H55O4PS2 and a molecular weight of 622.92 g/mol. Its IUPAC name is bis(1-phenoxyundecan-2-yloxy)-sulfanyl-sulfanylidene-λ5-phosphane.
| Compound Name | bis(1-phenoxyundecan-2-yloxy)-sulfanyl-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 88718459 |
| Molecular Formula | C34H55O4PS2 |
| Molecular Weight | 622.92 g/mol |
| Exact Mass | 622.33 |
| IUPAC Name | bis(1-phenoxyundecan-2-yloxy)-sulfanyl-sulfanylidene-λ5-phosphane |
| SMILES | CCCCCCCCCC(COc1ccccc1)OP(=S)(S)OC(CCCCCCCCC)COc1ccccc1 |
| InChI | InChI=1S/C34H55O4PS2/c1-3-5-7-9-11-13-17-27-33(29-35-31-23-19-15-20-24-31)37-39(40,41)38-34(28-18-14-12-10-8-6-4-2)30-36-32-25-21-16-22-26-32/h15-16,19-26,33-34H,3-14,17-18,27-30H2,1-2H3,(H,40,41) |
| InChIKey | QGYDMUAYAKXQNL-UHFFFAOYSA-N |
| XLogP | 11.35 |
| TPSA | 36.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.92 |
| LogP ≤ 5 | 11.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|