C23H25BrN2O4 — CID 88723076
ethyl 2-[4-[(3-benzoylimidazol-1-ium-1-yl)methyl]phenoxy]-2-methylpropanoate bromide (PubChem CID 88723076) has the molecular formula C23H25BrN2O4 and a molecular weight of 473.37 g/mol. Its IUPAC name is ethyl 2-[4-[(3-benzoylimidazol-1-ium-1-yl)methyl]phenoxy]-2-methylpropanoate bromide.
| Compound Name | ethyl 2-[4-[(3-benzoylimidazol-1-ium-1-yl)methyl]phenoxy]-2-methylpropanoate bromide |
|---|---|
| PubChem CID | 88723076 |
| Molecular Formula | C23H25BrN2O4 |
| Molecular Weight | 473.37 g/mol |
| Exact Mass | 472.10 |
| IUPAC Name | ethyl 2-[4-[(3-benzoylimidazol-1-ium-1-yl)methyl]phenoxy]-2-methylpropanoate bromide |
| SMILES | CCOC(=O)C(C)(C)Oc1ccc(C[n+]2ccn(C(=O)c3ccccc3)c2)cc1.[Br-] |
| InChI | InChI=1S/C23H25N2O4.BrH/c1-4-28-22(27)23(2,3)29-20-12-10-18(11-13-20)16-24-14-15-25(17-24)21(26)19-8-6-5-7-9-19;/h5-15,17H,4,16H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | NWMNQYLCXXEPEV-UHFFFAOYSA-M |
| XLogP | 0.24 |
| TPSA | 61.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.37 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|