C9H14N2O5S — CID 88737553
(3R,4R,5S,6R)-2-(2-amino-1,3-thiazol-4-yl)-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 88737553) has the molecular formula C9H14N2O5S and a molecular weight of 262.29 g/mol. Its IUPAC name is (3R,4R,5S,6R)-2-(2-amino-1,3-thiazol-4-yl)-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (3R,4R,5S,6R)-2-(2-amino-1,3-thiazol-4-yl)-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 88737553 |
| Molecular Formula | C9H14N2O5S |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | (3R,4R,5S,6R)-2-(2-amino-1,3-thiazol-4-yl)-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | Nc1nc(C2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cs1 |
| InChI | InChI=1S/C9H14N2O5S/c10-9-11-3(2-17-9)8-7(15)6(14)5(13)4(1-12)16-8/h2,4-8,12-15H,1H2,(H2,10,11)/t4-,5-,6+,7-,8?/m1/s1 |
| InChIKey | YGCZJISCUJRMOD-KEWYIRBNSA-N |
| XLogP | -1.76 |
| TPSA | 129.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |