About (2-hydroxybenzoyl) 2-carboxyoxy-3-methylbenzoate
(2-hydroxybenzoyl) 2-carboxyoxy-3-methylbenzoate (PubChem CID 88744397) has the molecular formula C16H12O7
and a molecular weight of 316.26 g/mol. Its IUPAC name is (2-hydroxybenzoyl) 2-carboxyoxy-3-methylbenzoate.
Molecular Properties
| Compound Name | (2-hydroxybenzoyl) 2-carboxyoxy-3-methylbenzoate |
| PubChem CID | 88744397 |
| Molecular Formula | C16H12O7 |
| Molecular Weight | 316.26 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | (2-hydroxybenzoyl) 2-carboxyoxy-3-methylbenzoate |
| SMILES | Cc1cccc(C(=O)OC(=O)c2ccccc2O)c1OC(=O)O |
| InChI | InChI=1S/C16H12O7/c1-9-5-4-7-11(13(9)22-16(20)21)15(19)23-14(18)10-6-2-3-8-12(10)17/h2-8,17H,1H3,(H,20,21) |
| InChIKey | BFHARXZFVCZLAM-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.26 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze (2-hydroxybenzoyl) 2-carboxyoxy-3-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-hydroxybenzoyl) 2-carboxyoxy-3-methylbenzoate?
The IUPAC name of (2-hydroxybenzoyl) 2-carboxyoxy-3-methylbenzoate (CID 88744397) is (2-hydroxybenzoyl) 2-carboxyoxy-3-methylbenzoate.
What is the SMILES notation for (2-hydroxybenzoyl) 2-carboxyoxy-3-methylbenzoate?
The canonical SMILES for (2-hydroxybenzoyl) 2-carboxyoxy-3-methylbenzoate is Cc1cccc(C(=O)OC(=O)c2ccccc2O)c1OC(=O)O.
What is the InChIKey of (2-hydroxybenzoyl) 2-carboxyoxy-3-methylbenzoate?
The InChIKey is BFHARXZFVCZLAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12O7/c1-9-5-4-7-11(13(9)22-16(20)21)15(19)23-14(18)10-6-2-3-8-12(10)17/h2-8,17H,1H3,(H,20,21).
What are the key properties of (2-hydroxybenzoyl) 2-carboxyoxy-3-methylbenzoate?
(2-hydroxybenzoyl) 2-carboxyoxy-3-methylbenzoate has a molecular weight of 316.26 g/mol, XLogP of 2.75, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-hydroxybenzoyl) 2-carboxyoxy-3-methylbenzoate is sourced from PubChem (CID 88744397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).