C14H25NO9 — CID 88750767
4-[bis(2-hydroxyethyl)amino]-3-oxobutanoic acid;hexanedioic acid (PubChem CID 88750767) has the molecular formula C14H25NO9 and a molecular weight of 351.35 g/mol. Its IUPAC name is 4-[bis(2-hydroxyethyl)amino]-3-oxobutanoic acid;hexanedioic acid.
| Compound Name | 4-[bis(2-hydroxyethyl)amino]-3-oxobutanoic acid;hexanedioic acid |
|---|---|
| PubChem CID | 88750767 |
| Molecular Formula | C14H25NO9 |
| Molecular Weight | 351.35 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | 4-[bis(2-hydroxyethyl)amino]-3-oxobutanoic acid;hexanedioic acid |
| SMILES | O=C(O)CC(=O)CN(CCO)CCO.O=C(O)CCCCC(=O)O |
| InChI | InChI=1S/C8H15NO5.C6H10O4/c10-3-1-9(2-4-11)6-7(12)5-8(13)14;7-5(8)3-1-2-4-6(9)10/h10-11H,1-6H2,(H,13,14);1-4H2,(H,7,8)(H,9,10) |
| InChIKey | UHPLHBXJGCLGLX-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 172.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.35 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|