About icosanedioic acid;propanedioic acid
icosanedioic acid;propanedioic acid (PubChem CID 87463757) has the molecular formula C23H42O8
and a molecular weight of 446.58 g/mol. Its IUPAC name is icosanedioic acid;propanedioic acid.
Molecular Properties
| Compound Name | icosanedioic acid;propanedioic acid |
| PubChem CID | 87463757 |
| Molecular Formula | C23H42O8 |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.29 |
| IUPAC Name | icosanedioic acid;propanedioic acid |
| SMILES | O=C(O)CC(=O)O.O=C(O)CCCCCCCCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C20H38O4.C3H4O4/c21-19(22)17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18-20(23)24;4-2(5)1-3(6)7/h1-18H2,(H,21,22)(H,23,24);1H2,(H,4,5)(H,6,7) |
| InChIKey | ARFSGSDNMPQREB-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze icosanedioic acid;propanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of icosanedioic acid;propanedioic acid?
The IUPAC name of icosanedioic acid;propanedioic acid (CID 87463757) is icosanedioic acid;propanedioic acid.
What is the SMILES notation for icosanedioic acid;propanedioic acid?
The canonical SMILES for icosanedioic acid;propanedioic acid is O=C(O)CC(=O)O.O=C(O)CCCCCCCCCCCCCCCCCCC(=O)O.
What is the InChIKey of icosanedioic acid;propanedioic acid?
The InChIKey is ARFSGSDNMPQREB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H38O4.C3H4O4/c21-19(22)17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18-20(23)24;4-2(5)1-3(6)7/h1-18H2,(H,21,22)(H,23,24);1H2,(H,4,5)(H,6,7).
What are the key properties of icosanedioic acid;propanedioic acid?
icosanedioic acid;propanedioic acid has a molecular weight of 446.58 g/mol, XLogP of 5.72, 21 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for icosanedioic acid;propanedioic acid is sourced from PubChem (CID 87463757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).