C11H18O8 — CID 159733947
octanedioic acid;propanedioic acid (PubChem CID 159733947) has the molecular formula C11H18O8 and a molecular weight of 278.26 g/mol. Its IUPAC name is octanedioic acid;propanedioic acid.
| Compound Name | octanedioic acid;propanedioic acid |
|---|---|
| PubChem CID | 159733947 |
| Molecular Formula | C11H18O8 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | octanedioic acid;propanedioic acid |
| SMILES | O=C(O)CC(=O)O.O=C(O)CCCCCCC(=O)O |
| InChI | InChI=1S/C8H14O4.C3H4O4/c9-7(10)5-3-1-2-4-6-8(11)12;4-2(5)1-3(6)7/h1-6H2,(H,9,10)(H,11,12);1H2,(H,4,5)(H,6,7) |
| InChIKey | NBPCKYREWGXNGD-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|