C13H12N2O6 — CID 88751287
(E)-4-(2,4-dinitro-6-prop-2-enylphenyl)but-2-enoic acid (PubChem CID 88751287) has the molecular formula C13H12N2O6 and a molecular weight of 292.25 g/mol. Its IUPAC name is (E)-4-(2,4-dinitro-6-prop-2-enylphenyl)but-2-enoic acid.
| Compound Name | (E)-4-(2,4-dinitro-6-prop-2-enylphenyl)but-2-enoic acid |
|---|---|
| PubChem CID | 88751287 |
| Molecular Formula | C13H12N2O6 |
| Molecular Weight | 292.25 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | (E)-4-(2,4-dinitro-6-prop-2-enylphenyl)but-2-enoic acid |
| SMILES | C=CCc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1C/C=C/C(=O)O |
| InChI | InChI=1S/C13H12N2O6/c1-2-4-9-7-10(14(18)19)8-12(15(20)21)11(9)5-3-6-13(16)17/h2-3,6-8H,1,4-5H2,(H,16,17)/b6-3+ |
| InChIKey | RJFLKPKCTYUSGK-ZZXKWVIFSA-N |
| XLogP | 2.41 |
| TPSA | 123.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.25 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|