C25H20F9NO6S2 — CID 88752306
benzhydryl (2S,5R,6S)-3,3-dimethyl-6-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyloxy)-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 88752306) has the molecular formula C25H20F9NO6S2 and a molecular weight of 665.55 g/mol. Its IUPAC name is benzhydryl (2S,5R,6S)-3,3-dimethyl-6-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyloxy)-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | benzhydryl (2S,5R,6S)-3,3-dimethyl-6-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyloxy)-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 88752306 |
| Molecular Formula | C25H20F9NO6S2 |
| Molecular Weight | 665.55 g/mol |
| Exact Mass | 665.06 |
| IUPAC Name | benzhydryl (2S,5R,6S)-3,3-dimethyl-6-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyloxy)-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CC1(C)S[C@@H]2[C@@H](OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)N2[C@H]1C(=O)OC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H20F9NO6S2/c1-21(2)17(20(37)40-15(13-9-5-3-6-10-13)14-11-7-4-8-12-14)35-18(36)16(19(35)42-21)41-43(38,39)25(33,34)23(28,29)22(26,27)24(30,31)32/h3-12,15-17,19H,1-2H3/t16-,17-,19+/m0/s1 |
| InChIKey | LDQLFWGUPNYAEQ-JENIJYKNSA-N |
| XLogP | 5.52 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.55 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|