C14H29N4O6P — CID 88759256
methyl-[[(2S)-2-[[(2S)-2-[[2-(methylamino)acetyl]amino]pentanoyl]amino]pentanoyl]amino]oxyphosphinic acid (PubChem CID 88759256) has the molecular formula C14H29N4O6P and a molecular weight of 380.38 g/mol. Its IUPAC name is methyl-[[(2S)-2-[[(2S)-2-[[2-(methylamino)acetyl]amino]pentanoyl]amino]pentanoyl]amino]oxyphosphinic acid.
| Compound Name | methyl-[[(2S)-2-[[(2S)-2-[[2-(methylamino)acetyl]amino]pentanoyl]amino]pentanoyl]amino]oxyphosphinic acid |
|---|---|
| PubChem CID | 88759256 |
| Molecular Formula | C14H29N4O6P |
| Molecular Weight | 380.38 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | methyl-[[(2S)-2-[[(2S)-2-[[2-(methylamino)acetyl]amino]pentanoyl]amino]pentanoyl]amino]oxyphosphinic acid |
| SMILES | CCC[C@H](NC(=O)CNC)C(=O)N[C@@H](CCC)C(=O)NOP(C)(=O)O |
| InChI | InChI=1S/C14H29N4O6P/c1-5-7-10(16-12(19)9-15-3)13(20)17-11(8-6-2)14(21)18-24-25(4,22)23/h10-11,15H,5-9H2,1-4H3,(H,16,19)(H,17,20)(H,18,21)(H,22,23)/t10-,11-/m0/s1 |
| InChIKey | OJSHCQUNOZHEIL-QWRGUYRKSA-N |
| XLogP | -0.36 |
| TPSA | 145.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.38 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|