C23H29ClN6O3 — CID 88762237
tert-butyl 4-[4-[(7-chloro-4-oxo-3,6-dihydropyrido[3,4-c]pyridazin-5-yl)amino]-2-methylphenyl]piperazine-1-carboxylate (PubChem CID 88762237) has the molecular formula C23H29ClN6O3 and a molecular weight of 472.98 g/mol. Its IUPAC name is tert-butyl 4-[4-[(7-chloro-4-oxo-3,6-dihydropyrido[3,4-c]pyridazin-5-yl)amino]-2-methylphenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[(7-chloro-4-oxo-3,6-dihydropyrido[3,4-c]pyridazin-5-yl)amino]-2-methylphenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 88762237 |
| Molecular Formula | C23H29ClN6O3 |
| Molecular Weight | 472.98 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | tert-butyl 4-[4-[(7-chloro-4-oxo-3,6-dihydropyrido[3,4-c]pyridazin-5-yl)amino]-2-methylphenyl]piperazine-1-carboxylate |
| SMILES | Cc1cc(NC2=C3C(=O)CN=NC3=CN(Cl)C2)ccc1N1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C23H29ClN6O3/c1-15-11-16(26-17-13-30(24)14-18-21(17)20(31)12-25-27-18)5-6-19(15)28-7-9-29(10-8-28)22(32)33-23(2,3)4/h5-6,11,14,26H,7-10,12-13H2,1-4H3 |
| InChIKey | SRMNIFYJBPVOML-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 89.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.98 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|